C14H15F2NO3 — CID 122118890
1-(2,3-difluorobenzoyl)-5-methylpiperidine-3-carboxylic acid (PubChem CID 122118890) has the molecular formula C14H15F2NO3 and a molecular weight of 283.27 g/mol. Its IUPAC name is 1-(2,3-difluorobenzoyl)-5-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-(2,3-difluorobenzoyl)-5-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122118890 |
| Molecular Formula | C14H15F2NO3 |
| Molecular Weight | 283.27 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 1-(2,3-difluorobenzoyl)-5-methylpiperidine-3-carboxylic acid |
| SMILES | CC1CC(C(=O)O)CN(C(=O)c2cccc(F)c2F)C1 |
| InChI | InChI=1S/C14H15F2NO3/c1-8-5-9(14(19)20)7-17(6-8)13(18)10-3-2-4-11(15)12(10)16/h2-4,8-9H,5-7H2,1H3,(H,19,20) |
| InChIKey | SEVFUUUEFLLOFZ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.27 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |