C15H16F3NO4 — CID 122117455
5-methyl-1-[2-(trifluoromethoxy)benzoyl]piperidine-3-carboxylic acid (PubChem CID 122117455) has the molecular formula C15H16F3NO4 and a molecular weight of 331.29 g/mol. Its IUPAC name is 5-methyl-1-[2-(trifluoromethoxy)benzoyl]piperidine-3-carboxylic acid.
| Compound Name | 5-methyl-1-[2-(trifluoromethoxy)benzoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122117455 |
| Molecular Formula | C15H16F3NO4 |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 5-methyl-1-[2-(trifluoromethoxy)benzoyl]piperidine-3-carboxylic acid |
| SMILES | CC1CC(C(=O)O)CN(C(=O)c2ccccc2OC(F)(F)F)C1 |
| InChI | InChI=1S/C15H16F3NO4/c1-9-6-10(14(21)22)8-19(7-9)13(20)11-4-2-3-5-12(11)23-15(16,17)18/h2-5,9-10H,6-8H2,1H3,(H,21,22) |
| InChIKey | UUQTYIOIZWAART-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |