C16H22N2O4 — CID 122102972
1-[(2-methoxy-6-methylphenyl)carbamoyl]-5-methylpiperidine-3-carboxylic acid (PubChem CID 122102972) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is 1-[(2-methoxy-6-methylphenyl)carbamoyl]-5-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-[(2-methoxy-6-methylphenyl)carbamoyl]-5-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122102972 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 1-[(2-methoxy-6-methylphenyl)carbamoyl]-5-methylpiperidine-3-carboxylic acid |
| SMILES | COc1cccc(C)c1NC(=O)N1CC(C)CC(C(=O)O)C1 |
| InChI | InChI=1S/C16H22N2O4/c1-10-7-12(15(19)20)9-18(8-10)16(21)17-14-11(2)5-4-6-13(14)22-3/h4-6,10,12H,7-9H2,1-3H3,(H,17,21)(H,19,20) |
| InChIKey | NSBGPXIJDBBOJB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |