About tert-butyl 4-(4-bromophenyl)piperidine-1-carboxylate;dioxane
tert-butyl 4-(4-bromophenyl)piperidine-1-carboxylate;dioxane (PubChem CID 175320052) has the molecular formula C20H30BrNO4
and a molecular weight of 428.37 g/mol. Its IUPAC name is tert-butyl 4-(4-bromophenyl)piperidine-1-carboxylate;dioxane.
Molecular Properties
| Compound Name | tert-butyl 4-(4-bromophenyl)piperidine-1-carboxylate;dioxane |
| PubChem CID | 175320052 |
| Molecular Formula | C20H30BrNO4 |
| Molecular Weight | 428.37 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | tert-butyl 4-(4-bromophenyl)piperidine-1-carboxylate;dioxane |
| SMILES | C1CCOOC1.CC(C)(C)OC(=O)N1CCC(c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C16H22BrNO2.C4H8O2/c1-16(2,3)20-15(19)18-10-8-13(9-11-18)12-4-6-14(17)7-5-12;1-2-4-6-5-3-1/h4-7,13H,8-11H2,1-3H3;1-4H2 |
| InChIKey | XHXZBDFSENVEBZ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.37 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-(4-bromophenyl)piperidine-1-carboxylate;dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-(4-bromophenyl)piperidine-1-carboxylate;dioxane?
The IUPAC name of tert-butyl 4-(4-bromophenyl)piperidine-1-carboxylate;dioxane (CID 175320052) is tert-butyl 4-(4-bromophenyl)piperidine-1-carboxylate;dioxane.
What is the SMILES notation for tert-butyl 4-(4-bromophenyl)piperidine-1-carboxylate;dioxane?
The canonical SMILES for tert-butyl 4-(4-bromophenyl)piperidine-1-carboxylate;dioxane is C1CCOOC1.CC(C)(C)OC(=O)N1CCC(c2ccc(Br)cc2)CC1.
What is the InChIKey of tert-butyl 4-(4-bromophenyl)piperidine-1-carboxylate;dioxane?
The InChIKey is XHXZBDFSENVEBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22BrNO2.C4H8O2/c1-16(2,3)20-15(19)18-10-8-13(9-11-18)12-4-6-14(17)7-5-12;1-2-4-6-5-3-1/h4-7,13H,8-11H2,1-3H3;1-4H2.
What are the key properties of tert-butyl 4-(4-bromophenyl)piperidine-1-carboxylate;dioxane?
tert-butyl 4-(4-bromophenyl)piperidine-1-carboxylate;dioxane has a molecular weight of 428.37 g/mol, XLogP of 5.29, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-(4-bromophenyl)piperidine-1-carboxylate;dioxane is sourced from PubChem (CID 175320052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).