C16H22F5NO3S — CID 140766642
tert-butyl 4-hydroxy-4-[4-(pentafluoro-λ6-sulfanyl)phenyl]piperidine-1-carboxylate (PubChem CID 140766642) has the molecular formula C16H22F5NO3S and a molecular weight of 403.41 g/mol. Its IUPAC name is tert-butyl 4-hydroxy-4-[4-(pentafluoro-λ6-sulfanyl)phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-hydroxy-4-[4-(pentafluoro-λ6-sulfanyl)phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 140766642 |
| Molecular Formula | C16H22F5NO3S |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | tert-butyl 4-hydroxy-4-[4-(pentafluoro-λ6-sulfanyl)phenyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(O)(c2ccc(S(F)(F)(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C16H22F5NO3S/c1-15(2,3)25-14(23)22-10-8-16(24,9-11-22)12-4-6-13(7-5-12)26(17,18,19,20)21/h4-7,24H,8-11H2,1-3H3 |
| InChIKey | DVKPRAHJWKWEBJ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |