C17H26N2O5S — CID 59465781
tert-butyl 4-hydroxy-4-[4-(methylsulfamoyl)phenyl]piperidine-1-carboxylate (PubChem CID 59465781) has the molecular formula C17H26N2O5S and a molecular weight of 370.47 g/mol. Its IUPAC name is tert-butyl 4-hydroxy-4-[4-(methylsulfamoyl)phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-hydroxy-4-[4-(methylsulfamoyl)phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59465781 |
| Molecular Formula | C17H26N2O5S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | tert-butyl 4-hydroxy-4-[4-(methylsulfamoyl)phenyl]piperidine-1-carboxylate |
| SMILES | CNS(=O)(=O)c1ccc(C2(O)CCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C17H26N2O5S/c1-16(2,3)24-15(20)19-11-9-17(21,10-12-19)13-5-7-14(8-6-13)25(22,23)18-4/h5-8,18,21H,9-12H2,1-4H3 |
| InChIKey | SANYQTWBDKQEMX-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |