C24H33NO6 — CID 139654515
1-O'-tert-butyl 1-O,1-O'-diethyl spiro[2H-indene-3,4'-piperidine]-1,1,1'-tricarboxylate (PubChem CID 139654515) has the molecular formula C24H33NO6 and a molecular weight of 431.53 g/mol. Its IUPAC name is 1-O'-tert-butyl 1-O,1-O'-diethyl spiro[2H-indene-3,4'-piperidine]-1,1,1'-tricarboxylate.
| Compound Name | 1-O'-tert-butyl 1-O,1-O'-diethyl spiro[2H-indene-3,4'-piperidine]-1,1,1'-tricarboxylate |
|---|---|
| PubChem CID | 139654515 |
| Molecular Formula | C24H33NO6 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | 1-O'-tert-butyl 1-O,1-O'-diethyl spiro[2H-indene-3,4'-piperidine]-1,1,1'-tricarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC2(CCN(C(=O)OC(C)(C)C)CC2)c2ccccc21 |
| InChI | InChI=1S/C24H33NO6/c1-6-29-19(26)24(20(27)30-7-2)16-23(17-10-8-9-11-18(17)24)12-14-25(15-13-23)21(28)31-22(3,4)5/h8-11H,6-7,12-16H2,1-5H3 |
| InChIKey | MFRBCBIGKXSXON-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|