C19H33NO5 — CID 176890588
tert-butyl 9-(2-ethoxy-2-oxoethyl)-9-hydroxy-3-azaspiro[5.5]undecane-3-carboxylate (PubChem CID 176890588) has the molecular formula C19H33NO5 and a molecular weight of 355.48 g/mol. Its IUPAC name is tert-butyl 9-(2-ethoxy-2-oxoethyl)-9-hydroxy-3-azaspiro[5.5]undecane-3-carboxylate.
| Compound Name | tert-butyl 9-(2-ethoxy-2-oxoethyl)-9-hydroxy-3-azaspiro[5.5]undecane-3-carboxylate |
|---|---|
| PubChem CID | 176890588 |
| Molecular Formula | C19H33NO5 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.24 |
| IUPAC Name | tert-butyl 9-(2-ethoxy-2-oxoethyl)-9-hydroxy-3-azaspiro[5.5]undecane-3-carboxylate |
| SMILES | CCOC(=O)CC1(O)CCC2(CCN(C(=O)OC(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C19H33NO5/c1-5-24-15(21)14-19(23)8-6-18(7-9-19)10-12-20(13-11-18)16(22)25-17(2,3)4/h23H,5-14H2,1-4H3 |
| InChIKey | JFXZYTQYRFHEER-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |