C12H10N2O2S — CID 105133667
3,4-dihydro-2H-chromen-8-yl(thiadiazol-4-yl)methanone (PubChem CID 105133667) has the molecular formula C12H10N2O2S and a molecular weight of 246.29 g/mol. Its IUPAC name is 3,4-dihydro-2H-chromen-8-yl(thiadiazol-4-yl)methanone.
| Compound Name | 3,4-dihydro-2H-chromen-8-yl(thiadiazol-4-yl)methanone |
|---|---|
| PubChem CID | 105133667 |
| Molecular Formula | C12H10N2O2S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 3,4-dihydro-2H-chromen-8-yl(thiadiazol-4-yl)methanone |
| SMILES | O=C(c1csnn1)c1cccc2c1OCCC2 |
| InChI | InChI=1S/C12H10N2O2S/c15-11(10-7-17-14-13-10)9-5-1-3-8-4-2-6-16-12(8)9/h1,3,5,7H,2,4,6H2 |
| InChIKey | SJPLVUUANXZLTR-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |