C14H13ClO2 — CID 106691062
(2-chlorofuran-3-yl)-(2,4,5-trimethylphenyl)methanone (PubChem CID 106691062) has the molecular formula C14H13ClO2 and a molecular weight of 248.71 g/mol. Its IUPAC name is (2-chlorofuran-3-yl)-(2,4,5-trimethylphenyl)methanone.
| Compound Name | (2-chlorofuran-3-yl)-(2,4,5-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 106691062 |
| Molecular Formula | C14H13ClO2 |
| Molecular Weight | 248.71 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | (2-chlorofuran-3-yl)-(2,4,5-trimethylphenyl)methanone |
| SMILES | Cc1cc(C)c(C(=O)c2ccoc2Cl)cc1C |
| InChI | InChI=1S/C14H13ClO2/c1-8-6-10(3)12(7-9(8)2)13(16)11-4-5-17-14(11)15/h4-7H,1-3H3 |
| InChIKey | TYHZAACOWBPUQI-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.71 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |