About cyclopenten-1-yl(2,3-dihydrofuran-5-yl)methanone
cyclopenten-1-yl(2,3-dihydrofuran-5-yl)methanone (PubChem CID 103448067) has the molecular formula C10H12O2
and a molecular weight of 164.20 g/mol. Its IUPAC name is cyclopenten-1-yl(2,3-dihydrofuran-5-yl)methanone.
Molecular Properties
| Compound Name | cyclopenten-1-yl(2,3-dihydrofuran-5-yl)methanone |
| PubChem CID | 103448067 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | cyclopenten-1-yl(2,3-dihydrofuran-5-yl)methanone |
| SMILES | O=C(C1=CCCC1)C1=CCCO1 |
| InChI | InChI=1S/C10H12O2/c11-10(8-4-1-2-5-8)9-6-3-7-12-9/h4,6H,1-3,5,7H2 |
| InChIKey | LWDMHMJMPJCRKM-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclopenten-1-yl(2,3-dihydrofuran-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenten-1-yl(2,3-dihydrofuran-5-yl)methanone?
The IUPAC name of cyclopenten-1-yl(2,3-dihydrofuran-5-yl)methanone (CID 103448067) is cyclopenten-1-yl(2,3-dihydrofuran-5-yl)methanone.
What is the SMILES notation for cyclopenten-1-yl(2,3-dihydrofuran-5-yl)methanone?
The canonical SMILES for cyclopenten-1-yl(2,3-dihydrofuran-5-yl)methanone is O=C(C1=CCCC1)C1=CCCO1.
What is the InChIKey of cyclopenten-1-yl(2,3-dihydrofuran-5-yl)methanone?
The InChIKey is LWDMHMJMPJCRKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2/c11-10(8-4-1-2-5-8)9-6-3-7-12-9/h4,6H,1-3,5,7H2.
What are the key properties of cyclopenten-1-yl(2,3-dihydrofuran-5-yl)methanone?
cyclopenten-1-yl(2,3-dihydrofuran-5-yl)methanone has a molecular weight of 164.20 g/mol, XLogP of 1.97, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenten-1-yl(2,3-dihydrofuran-5-yl)methanone is sourced from PubChem (CID 103448067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).