C6H6F2O2 — CID 102651098
1-(2,3-dihydrofuran-5-yl)-2,2-difluoroethanone (PubChem CID 102651098) has the molecular formula C6H6F2O2 and a molecular weight of 148.11 g/mol. Its IUPAC name is 1-(2,3-dihydrofuran-5-yl)-2,2-difluoroethanone.
| Compound Name | 1-(2,3-dihydrofuran-5-yl)-2,2-difluoroethanone |
|---|---|
| PubChem CID | 102651098 |
| Molecular Formula | C6H6F2O2 |
| Molecular Weight | 148.11 g/mol |
| Exact Mass | 148.03 |
| IUPAC Name | 1-(2,3-dihydrofuran-5-yl)-2,2-difluoroethanone |
| SMILES | O=C(C1=CCCO1)C(F)F |
| InChI | InChI=1S/C6H6F2O2/c7-6(8)5(9)4-2-1-3-10-4/h2,6H,1,3H2 |
| InChIKey | HLUXTVRTGWOWFU-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.11 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |