C10H8BrNO2 — CID 175204444
(4-bromophenyl)-(4,5-dihydro-1,3-oxazol-2-yl)methanone (PubChem CID 175204444) has the molecular formula C10H8BrNO2 and a molecular weight of 254.08 g/mol. Its IUPAC name is (4-bromophenyl)-(4,5-dihydro-1,3-oxazol-2-yl)methanone.
| Compound Name | (4-bromophenyl)-(4,5-dihydro-1,3-oxazol-2-yl)methanone |
|---|---|
| PubChem CID | 175204444 |
| Molecular Formula | C10H8BrNO2 |
| Molecular Weight | 254.08 g/mol |
| Exact Mass | 252.97 |
| IUPAC Name | (4-bromophenyl)-(4,5-dihydro-1,3-oxazol-2-yl)methanone |
| SMILES | O=C(C1=NCCO1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C10H8BrNO2/c11-8-3-1-7(2-4-8)9(13)10-12-5-6-14-10/h1-4H,5-6H2 |
| InChIKey | QVUMLMNWGYUNRC-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.08 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |