About 4,5-dihydro-1,3-oxazol-2-yl-(4-methylphenyl)methanone
4,5-dihydro-1,3-oxazol-2-yl-(4-methylphenyl)methanone (PubChem CID 90815370) has the molecular formula C11H11NO2
and a molecular weight of 189.21 g/mol. Its IUPAC name is 4,5-dihydro-1,3-oxazol-2-yl-(4-methylphenyl)methanone.
Analyze 4,5-dihydro-1,3-oxazol-2-yl-(4-methylphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dihydro-1,3-oxazol-2-yl-(4-methylphenyl)methanone?
The IUPAC name of 4,5-dihydro-1,3-oxazol-2-yl-(4-methylphenyl)methanone (CID 90815370) is 4,5-dihydro-1,3-oxazol-2-yl-(4-methylphenyl)methanone.
What is the SMILES notation for 4,5-dihydro-1,3-oxazol-2-yl-(4-methylphenyl)methanone?
The canonical SMILES for 4,5-dihydro-1,3-oxazol-2-yl-(4-methylphenyl)methanone is Cc1ccc(C(=O)C2=NCCO2)cc1.
What is the InChIKey of 4,5-dihydro-1,3-oxazol-2-yl-(4-methylphenyl)methanone?
The InChIKey is UQXDHLKNHAJCMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO2/c1-8-2-4-9(5-3-8)10(13)11-12-6-7-14-11/h2-5H,6-7H2,1H3.
What are the key properties of 4,5-dihydro-1,3-oxazol-2-yl-(4-methylphenyl)methanone?
4,5-dihydro-1,3-oxazol-2-yl-(4-methylphenyl)methanone has a molecular weight of 189.21 g/mol, XLogP of 1.61, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dihydro-1,3-oxazol-2-yl-(4-methylphenyl)methanone is sourced from PubChem (CID 90815370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).