C26H30ClNO3 — CID 42406532
(E)-3-(2-chlorophenyl)-N-cyclopentyl-N-[[3-[(3-methyloxetan-3-yl)methoxy]phenyl]methyl]prop-2-enamide (PubChem CID 42406532) has the molecular formula C26H30ClNO3 and a molecular weight of 439.98 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-cyclopentyl-N-[[3-[(3-methyloxetan-3-yl)methoxy]phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-cyclopentyl-N-[[3-[(3-methyloxetan-3-yl)methoxy]phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 42406532 |
| Molecular Formula | C26H30ClNO3 |
| Molecular Weight | 439.98 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-cyclopentyl-N-[[3-[(3-methyloxetan-3-yl)methoxy]phenyl]methyl]prop-2-enamide |
| SMILES | CC1(COc2cccc(CN(C(=O)/C=C/c3ccccc3Cl)C3CCCC3)c2)COC1 |
| InChI | InChI=1S/C26H30ClNO3/c1-26(17-30-18-26)19-31-23-11-6-7-20(15-23)16-28(22-9-3-4-10-22)25(29)14-13-21-8-2-5-12-24(21)27/h2,5-8,11-15,22H,3-4,9-10,16-19H2,1H3/b14-13+ |
| InChIKey | SHPFXODVZRQXOU-BUHFOSPRSA-N |
| XLogP | 5.74 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.98 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|