C25H30ClNO3 — CID 45236472
(E)-3-(2-chlorophenyl)-N-cyclopentyl-N-[[4-(1-methoxypropan-2-yloxy)phenyl]methyl]prop-2-enamide (PubChem CID 45236472) has the molecular formula C25H30ClNO3 and a molecular weight of 427.97 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-cyclopentyl-N-[[4-(1-methoxypropan-2-yloxy)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-cyclopentyl-N-[[4-(1-methoxypropan-2-yloxy)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 45236472 |
| Molecular Formula | C25H30ClNO3 |
| Molecular Weight | 427.97 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-cyclopentyl-N-[[4-(1-methoxypropan-2-yloxy)phenyl]methyl]prop-2-enamide |
| SMILES | COCC(C)Oc1ccc(CN(C(=O)/C=C/c2ccccc2Cl)C2CCCC2)cc1 |
| InChI | InChI=1S/C25H30ClNO3/c1-19(18-29-2)30-23-14-11-20(12-15-23)17-27(22-8-4-5-9-22)25(28)16-13-21-7-3-6-10-24(21)26/h3,6-7,10-16,19,22H,4-5,8-9,17-18H2,1-2H3/b16-13+ |
| InChIKey | VWVOODIQENUKBG-DTQAZKPQSA-N |
| XLogP | 5.74 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.97 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|