C19H17ClFNO — CID 126801006
3-(2-chlorophenyl)-N-cyclopropyl-N-[(2-fluorophenyl)methyl]prop-2-enamide (PubChem CID 126801006) has the molecular formula C19H17ClFNO and a molecular weight of 329.80 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-cyclopropyl-N-[(2-fluorophenyl)methyl]prop-2-enamide.
| Compound Name | 3-(2-chlorophenyl)-N-cyclopropyl-N-[(2-fluorophenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 126801006 |
| Molecular Formula | C19H17ClFNO |
| Molecular Weight | 329.80 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 3-(2-chlorophenyl)-N-cyclopropyl-N-[(2-fluorophenyl)methyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccccc1Cl)N(Cc1ccccc1F)C1CC1 |
| InChI | InChI=1S/C19H17ClFNO/c20-17-7-3-1-5-14(17)9-12-19(23)22(16-10-11-16)13-15-6-2-4-8-18(15)21/h1-9,12,16H,10-11,13H2 |
| InChIKey | FTOYVIDHWFPYSZ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.80 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|