C24H22FN3O — CID 34577313
(E)-3-[1-(2-cyanoethyl)indol-3-yl]-N-cyclopropyl-N-[(2-fluorophenyl)methyl]prop-2-enamide (PubChem CID 34577313) has the molecular formula C24H22FN3O and a molecular weight of 387.46 g/mol. Its IUPAC name is (E)-3-[1-(2-cyanoethyl)indol-3-yl]-N-cyclopropyl-N-[(2-fluorophenyl)methyl]prop-2-enamide.
| Compound Name | (E)-3-[1-(2-cyanoethyl)indol-3-yl]-N-cyclopropyl-N-[(2-fluorophenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 34577313 |
| Molecular Formula | C24H22FN3O |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | (E)-3-[1-(2-cyanoethyl)indol-3-yl]-N-cyclopropyl-N-[(2-fluorophenyl)methyl]prop-2-enamide |
| SMILES | N#CCCn1cc(/C=C/C(=O)N(Cc2ccccc2F)C2CC2)c2ccccc21 |
| InChI | InChI=1S/C24H22FN3O/c25-22-8-3-1-6-19(22)17-28(20-11-12-20)24(29)13-10-18-16-27(15-5-14-26)23-9-4-2-7-21(18)23/h1-4,6-10,13,16,20H,5,11-12,15,17H2/b13-10+ |
| InChIKey | TZCBZFULTQNWQC-JLHYYAGUSA-N |
| XLogP | 4.90 |
| TPSA | 49.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|