C16H11F3O2 — CID 65202921
3-[4-[(2,3-difluorophenyl)methoxy]-2-fluorophenyl]prop-2-yn-1-ol (PubChem CID 65202921) has the molecular formula C16H11F3O2 and a molecular weight of 292.26 g/mol. Its IUPAC name is 3-[4-[(2,3-difluorophenyl)methoxy]-2-fluorophenyl]prop-2-yn-1-ol.
| Compound Name | 3-[4-[(2,3-difluorophenyl)methoxy]-2-fluorophenyl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 65202921 |
| Molecular Formula | C16H11F3O2 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 3-[4-[(2,3-difluorophenyl)methoxy]-2-fluorophenyl]prop-2-yn-1-ol |
| SMILES | OCC#Cc1ccc(OCc2cccc(F)c2F)cc1F |
| InChI | InChI=1S/C16H11F3O2/c17-14-5-1-3-12(16(14)19)10-21-13-7-6-11(4-2-8-20)15(18)9-13/h1,3,5-7,9,20H,8,10H2 |
| InChIKey | YNPQTFPQRKBVFY-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|