C16H10ClF3O — CID 114932796
1-(3-chloroprop-1-ynyl)-4-[(2,6-difluorophenyl)methoxy]-2-fluorobenzene (PubChem CID 114932796) has the molecular formula C16H10ClF3O and a molecular weight of 310.70 g/mol. Its IUPAC name is 1-(3-chloroprop-1-ynyl)-4-[(2,6-difluorophenyl)methoxy]-2-fluorobenzene.
| Compound Name | 1-(3-chloroprop-1-ynyl)-4-[(2,6-difluorophenyl)methoxy]-2-fluorobenzene |
|---|---|
| PubChem CID | 114932796 |
| Molecular Formula | C16H10ClF3O |
| Molecular Weight | 310.70 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 1-(3-chloroprop-1-ynyl)-4-[(2,6-difluorophenyl)methoxy]-2-fluorobenzene |
| SMILES | Fc1cc(OCc2c(F)cccc2F)ccc1C#CCCl |
| InChI | InChI=1S/C16H10ClF3O/c17-8-2-3-11-6-7-12(9-16(11)20)21-10-13-14(18)4-1-5-15(13)19/h1,4-7,9H,8,10H2 |
| InChIKey | KVHHMXRFLQZJIR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.70 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|