C17H13Cl2FO — CID 115984008
2-chloro-1-[[4-(3-chloroprop-1-ynyl)-3-methylphenoxy]methyl]-3-fluorobenzene (PubChem CID 115984008) has the molecular formula C17H13Cl2FO and a molecular weight of 323.19 g/mol. Its IUPAC name is 2-chloro-1-[[4-(3-chloroprop-1-ynyl)-3-methylphenoxy]methyl]-3-fluorobenzene.
| Compound Name | 2-chloro-1-[[4-(3-chloroprop-1-ynyl)-3-methylphenoxy]methyl]-3-fluorobenzene |
|---|---|
| PubChem CID | 115984008 |
| Molecular Formula | C17H13Cl2FO |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 2-chloro-1-[[4-(3-chloroprop-1-ynyl)-3-methylphenoxy]methyl]-3-fluorobenzene |
| SMILES | Cc1cc(OCc2cccc(F)c2Cl)ccc1C#CCCl |
| InChI | InChI=1S/C17H13Cl2FO/c1-12-10-15(8-7-13(12)5-3-9-18)21-11-14-4-2-6-16(20)17(14)19/h2,4,6-8,10H,9,11H2,1H3 |
| InChIKey | IJYWBOIJSJLJEM-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|