C18H16ClFO — CID 65202293
1-(3-chloroprop-1-ynyl)-4-[(3,5-dimethylphenyl)methoxy]-2-fluorobenzene (PubChem CID 65202293) has the molecular formula C18H16ClFO and a molecular weight of 302.78 g/mol. Its IUPAC name is 1-(3-chloroprop-1-ynyl)-4-[(3,5-dimethylphenyl)methoxy]-2-fluorobenzene.
| Compound Name | 1-(3-chloroprop-1-ynyl)-4-[(3,5-dimethylphenyl)methoxy]-2-fluorobenzene |
|---|---|
| PubChem CID | 65202293 |
| Molecular Formula | C18H16ClFO |
| Molecular Weight | 302.78 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 1-(3-chloroprop-1-ynyl)-4-[(3,5-dimethylphenyl)methoxy]-2-fluorobenzene |
| SMILES | Cc1cc(C)cc(COc2ccc(C#CCCl)c(F)c2)c1 |
| InChI | InChI=1S/C18H16ClFO/c1-13-8-14(2)10-15(9-13)12-21-17-6-5-16(4-3-7-19)18(20)11-17/h5-6,8-11H,7,12H2,1-2H3 |
| InChIKey | QUMWBNITZYUEGD-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.78 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|