C17H20FNO — CID 107716098
1-[4-[(3,5-dimethylphenyl)methoxy]-2-fluorophenyl]ethanamine (PubChem CID 107716098) has the molecular formula C17H20FNO and a molecular weight of 273.35 g/mol. Its IUPAC name is 1-[4-[(3,5-dimethylphenyl)methoxy]-2-fluorophenyl]ethanamine.
| Compound Name | 1-[4-[(3,5-dimethylphenyl)methoxy]-2-fluorophenyl]ethanamine |
|---|---|
| PubChem CID | 107716098 |
| Molecular Formula | C17H20FNO |
| Molecular Weight | 273.35 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 1-[4-[(3,5-dimethylphenyl)methoxy]-2-fluorophenyl]ethanamine |
| SMILES | Cc1cc(C)cc(COc2ccc(C(C)N)c(F)c2)c1 |
| InChI | InChI=1S/C17H20FNO/c1-11-6-12(2)8-14(7-11)10-20-15-4-5-16(13(3)19)17(18)9-15/h4-9,13H,10,19H2,1-3H3 |
| InChIKey | VTMPBGOJVQJSRT-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.35 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |