C15H15F2NO — CID 107718259
(1R)-1-[2-fluoro-4-[(4-fluorophenyl)methoxy]phenyl]ethanamine (PubChem CID 107718259) has the molecular formula C15H15F2NO and a molecular weight of 263.29 g/mol. Its IUPAC name is (1R)-1-[2-fluoro-4-[(4-fluorophenyl)methoxy]phenyl]ethanamine.
| Compound Name | (1R)-1-[2-fluoro-4-[(4-fluorophenyl)methoxy]phenyl]ethanamine |
|---|---|
| PubChem CID | 107718259 |
| Molecular Formula | C15H15F2NO |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | (1R)-1-[2-fluoro-4-[(4-fluorophenyl)methoxy]phenyl]ethanamine |
| SMILES | C[C@@H](N)c1ccc(OCc2ccc(F)cc2)cc1F |
| InChI | InChI=1S/C15H15F2NO/c1-10(18)14-7-6-13(8-15(14)17)19-9-11-2-4-12(16)5-3-11/h2-8,10H,9,18H2,1H3/t10-/m1/s1 |
| InChIKey | BBYOVPJBTRHZID-SNVBAGLBSA-N |
| XLogP | 3.56 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |