C13H10FNO3 — CID 65202756
3-[2-fluoro-4-(1,2-oxazol-4-ylmethoxy)phenyl]prop-2-yn-1-ol (PubChem CID 65202756) has the molecular formula C13H10FNO3 and a molecular weight of 247.22 g/mol. Its IUPAC name is 3-[2-fluoro-4-(1,2-oxazol-4-ylmethoxy)phenyl]prop-2-yn-1-ol.
| Compound Name | 3-[2-fluoro-4-(1,2-oxazol-4-ylmethoxy)phenyl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 65202756 |
| Molecular Formula | C13H10FNO3 |
| Molecular Weight | 247.22 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 3-[2-fluoro-4-(1,2-oxazol-4-ylmethoxy)phenyl]prop-2-yn-1-ol |
| SMILES | OCC#Cc1ccc(OCc2cnoc2)cc1F |
| InChI | InChI=1S/C13H10FNO3/c14-13-6-12(4-3-11(13)2-1-5-16)17-8-10-7-15-18-9-10/h3-4,6-7,9,16H,5,8H2 |
| InChIKey | DNSCEIAPOABRON-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.22 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|