C10H8FNO2 — CID 61227729
4-[(4-fluorophenoxy)methyl]-1,2-oxazole (PubChem CID 61227729) has the molecular formula C10H8FNO2 and a molecular weight of 193.18 g/mol. Its IUPAC name is 4-[(4-fluorophenoxy)methyl]-1,2-oxazole.
| Compound Name | 4-[(4-fluorophenoxy)methyl]-1,2-oxazole |
|---|---|
| PubChem CID | 61227729 |
| Molecular Formula | C10H8FNO2 |
| Molecular Weight | 193.18 g/mol |
| Exact Mass | 193.05 |
| IUPAC Name | 4-[(4-fluorophenoxy)methyl]-1,2-oxazole |
| SMILES | Fc1ccc(OCc2cnoc2)cc1 |
| InChI | InChI=1S/C10H8FNO2/c11-9-1-3-10(4-2-9)13-6-8-5-12-14-7-8/h1-5,7H,6H2 |
| InChIKey | GLUFNQYODIUAFB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.18 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |