C11H7F2NO3 — CID 79891546
3,5-difluoro-4-(1,2-oxazol-4-ylmethoxy)benzaldehyde (PubChem CID 79891546) has the molecular formula C11H7F2NO3 and a molecular weight of 239.18 g/mol. Its IUPAC name is 3,5-difluoro-4-(1,2-oxazol-4-ylmethoxy)benzaldehyde.
| Compound Name | 3,5-difluoro-4-(1,2-oxazol-4-ylmethoxy)benzaldehyde |
|---|---|
| PubChem CID | 79891546 |
| Molecular Formula | C11H7F2NO3 |
| Molecular Weight | 239.18 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | 3,5-difluoro-4-(1,2-oxazol-4-ylmethoxy)benzaldehyde |
| SMILES | O=Cc1cc(F)c(OCc2cnoc2)c(F)c1 |
| InChI | InChI=1S/C11H7F2NO3/c12-9-1-7(4-15)2-10(13)11(9)16-5-8-3-14-17-6-8/h1-4,6H,5H2 |
| InChIKey | NUSZYUICEKHFNH-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.18 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|