C14H9F3O2 — CID 122476157
3-[(2,4,6-trifluorophenoxy)methyl]benzaldehyde (PubChem CID 122476157) has the molecular formula C14H9F3O2 and a molecular weight of 266.22 g/mol. Its IUPAC name is 3-[(2,4,6-trifluorophenoxy)methyl]benzaldehyde.
| Compound Name | 3-[(2,4,6-trifluorophenoxy)methyl]benzaldehyde |
|---|---|
| PubChem CID | 122476157 |
| Molecular Formula | C14H9F3O2 |
| Molecular Weight | 266.22 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 3-[(2,4,6-trifluorophenoxy)methyl]benzaldehyde |
| SMILES | O=Cc1cccc(COc2c(F)cc(F)cc2F)c1 |
| InChI | InChI=1S/C14H9F3O2/c15-11-5-12(16)14(13(17)6-11)19-8-10-3-1-2-9(4-10)7-18/h1-7H,8H2 |
| InChIKey | YBHCLXIIEKEWMZ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.22 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|