C20H13F3O2 — CID 58293982
3-[[4-(2,4,5-trifluorophenyl)phenoxy]methyl]benzaldehyde (PubChem CID 58293982) has the molecular formula C20H13F3O2 and a molecular weight of 342.32 g/mol. Its IUPAC name is 3-[[4-(2,4,5-trifluorophenyl)phenoxy]methyl]benzaldehyde.
| Compound Name | 3-[[4-(2,4,5-trifluorophenyl)phenoxy]methyl]benzaldehyde |
|---|---|
| PubChem CID | 58293982 |
| Molecular Formula | C20H13F3O2 |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 3-[[4-(2,4,5-trifluorophenyl)phenoxy]methyl]benzaldehyde |
| SMILES | O=Cc1cccc(COc2ccc(-c3cc(F)c(F)cc3F)cc2)c1 |
| InChI | InChI=1S/C20H13F3O2/c21-18-10-20(23)19(22)9-17(18)15-4-6-16(7-5-15)25-12-14-3-1-2-13(8-14)11-24/h1-11H,12H2 |
| InChIKey | WBAGZRNUQPGUQR-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|