C25H19F3N2O2 — CID 67150366
(2S)-1-[3-[[4-(2,4,5-trifluorophenyl)phenoxy]methyl]benzoyl]pyrrolidine-2-carbonitrile (PubChem CID 67150366) has the molecular formula C25H19F3N2O2 and a molecular weight of 436.43 g/mol. Its IUPAC name is (2S)-1-[3-[[4-(2,4,5-trifluorophenyl)phenoxy]methyl]benzoyl]pyrrolidine-2-carbonitrile.
| Compound Name | (2S)-1-[3-[[4-(2,4,5-trifluorophenyl)phenoxy]methyl]benzoyl]pyrrolidine-2-carbonitrile |
|---|---|
| PubChem CID | 67150366 |
| Molecular Formula | C25H19F3N2O2 |
| Molecular Weight | 436.43 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | (2S)-1-[3-[[4-(2,4,5-trifluorophenyl)phenoxy]methyl]benzoyl]pyrrolidine-2-carbonitrile |
| SMILES | N#C[C@@H]1CCCN1C(=O)c1cccc(COc2ccc(-c3cc(F)c(F)cc3F)cc2)c1 |
| InChI | InChI=1S/C25H19F3N2O2/c26-22-13-24(28)23(27)12-21(22)17-6-8-20(9-7-17)32-15-16-3-1-4-18(11-16)25(31)30-10-2-5-19(30)14-29/h1,3-4,6-9,11-13,19H,2,5,10,15H2/t19-/m0/s1 |
| InChIKey | CJFRTQFAWJWRKL-IBGZPJMESA-N |
| XLogP | 5.48 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.43 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|