C22H14F2O4 — CID 90384393
3-[[4-(4,5-difluoro-1-benzofuran-7-yl)phenoxy]methyl]benzoic acid (PubChem CID 90384393) has the molecular formula C22H14F2O4 and a molecular weight of 380.35 g/mol. Its IUPAC name is 3-[[4-(4,5-difluoro-1-benzofuran-7-yl)phenoxy]methyl]benzoic acid.
| Compound Name | 3-[[4-(4,5-difluoro-1-benzofuran-7-yl)phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 90384393 |
| Molecular Formula | C22H14F2O4 |
| Molecular Weight | 380.35 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 3-[[4-(4,5-difluoro-1-benzofuran-7-yl)phenoxy]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(COc2ccc(-c3cc(F)c(F)c4ccoc34)cc2)c1 |
| InChI | InChI=1S/C22H14F2O4/c23-19-11-18(21-17(20(19)24)8-9-27-21)14-4-6-16(7-5-14)28-12-13-2-1-3-15(10-13)22(25)26/h1-11H,12H2,(H,25,26) |
| InChIKey | LOTMVYKPRCCCLR-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.35 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |