C11H8N2O2 — CID 60871497
3-(1,2-oxazol-4-ylmethoxy)benzonitrile (PubChem CID 60871497) has the molecular formula C11H8N2O2 and a molecular weight of 200.20 g/mol. Its IUPAC name is 3-(1,2-oxazol-4-ylmethoxy)benzonitrile.
| Compound Name | 3-(1,2-oxazol-4-ylmethoxy)benzonitrile |
|---|---|
| PubChem CID | 60871497 |
| Molecular Formula | C11H8N2O2 |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 3-(1,2-oxazol-4-ylmethoxy)benzonitrile |
| SMILES | N#Cc1cccc(OCc2cnoc2)c1 |
| InChI | InChI=1S/C11H8N2O2/c12-5-9-2-1-3-11(4-9)14-7-10-6-13-15-8-10/h1-4,6,8H,7H2 |
| InChIKey | RTEPMLAZVISKIN-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 59.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |