C13H12N2O3 — CID 61230060
3-ethoxy-4-(1,2-oxazol-4-ylmethoxy)benzonitrile (PubChem CID 61230060) has the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. Its IUPAC name is 3-ethoxy-4-(1,2-oxazol-4-ylmethoxy)benzonitrile.
| Compound Name | 3-ethoxy-4-(1,2-oxazol-4-ylmethoxy)benzonitrile |
|---|---|
| PubChem CID | 61230060 |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 3-ethoxy-4-(1,2-oxazol-4-ylmethoxy)benzonitrile |
| SMILES | CCOc1cc(C#N)ccc1OCc1cnoc1 |
| InChI | InChI=1S/C13H12N2O3/c1-2-16-13-5-10(6-14)3-4-12(13)17-8-11-7-15-18-9-11/h3-5,7,9H,2,8H2,1H3 |
| InChIKey | ZTZLQFAGWGOXOC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |