C11H9N3O2 — CID 61388584
3-amino-4-(1,2-oxazol-4-ylmethoxy)benzonitrile (PubChem CID 61388584) has the molecular formula C11H9N3O2 and a molecular weight of 215.21 g/mol. Its IUPAC name is 3-amino-4-(1,2-oxazol-4-ylmethoxy)benzonitrile.
| Compound Name | 3-amino-4-(1,2-oxazol-4-ylmethoxy)benzonitrile |
|---|---|
| PubChem CID | 61388584 |
| Molecular Formula | C11H9N3O2 |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 3-amino-4-(1,2-oxazol-4-ylmethoxy)benzonitrile |
| SMILES | N#Cc1ccc(OCc2cnoc2)c(N)c1 |
| InChI | InChI=1S/C11H9N3O2/c12-4-8-1-2-11(10(13)3-8)15-6-9-5-14-16-7-9/h1-3,5,7H,6,13H2 |
| InChIKey | HPMMIAFABUUIBP-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 85.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|