C11H7ClN2O2 — CID 114322638
4-chloro-2-(1,2-oxazol-4-ylmethoxy)benzonitrile (PubChem CID 114322638) has the molecular formula C11H7ClN2O2 and a molecular weight of 234.64 g/mol. Its IUPAC name is 4-chloro-2-(1,2-oxazol-4-ylmethoxy)benzonitrile.
| Compound Name | 4-chloro-2-(1,2-oxazol-4-ylmethoxy)benzonitrile |
|---|---|
| PubChem CID | 114322638 |
| Molecular Formula | C11H7ClN2O2 |
| Molecular Weight | 234.64 g/mol |
| Exact Mass | 234.02 |
| IUPAC Name | 4-chloro-2-(1,2-oxazol-4-ylmethoxy)benzonitrile |
| SMILES | N#Cc1ccc(Cl)cc1OCc1cnoc1 |
| InChI | InChI=1S/C11H7ClN2O2/c12-10-2-1-9(4-13)11(3-10)15-6-8-5-14-16-7-8/h1-3,5,7H,6H2 |
| InChIKey | XYAPMCKKHZFKSX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 59.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.64 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |