C17H14FNO2 — CID 141170966
3-[[4-[(4-fluorophenyl)methoxy]phenyl]methyl]-1,2-oxazole (PubChem CID 141170966) has the molecular formula C17H14FNO2 and a molecular weight of 283.30 g/mol. Its IUPAC name is 3-[[4-[(4-fluorophenyl)methoxy]phenyl]methyl]-1,2-oxazole.
| Compound Name | 3-[[4-[(4-fluorophenyl)methoxy]phenyl]methyl]-1,2-oxazole |
|---|---|
| PubChem CID | 141170966 |
| Molecular Formula | C17H14FNO2 |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 3-[[4-[(4-fluorophenyl)methoxy]phenyl]methyl]-1,2-oxazole |
| SMILES | Fc1ccc(COc2ccc(Cc3ccon3)cc2)cc1 |
| InChI | InChI=1S/C17H14FNO2/c18-15-5-1-14(2-6-15)12-20-17-7-3-13(4-8-17)11-16-9-10-21-19-16/h1-10H,11-12H2 |
| InChIKey | YGMDAIJAPGTFRU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |