C10H8ClNO2 — CID 117233359
4-[(4-chlorophenyl)methoxy]-1,2-oxazole (PubChem CID 117233359) has the molecular formula C10H8ClNO2 and a molecular weight of 209.63 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methoxy]-1,2-oxazole.
| Compound Name | 4-[(4-chlorophenyl)methoxy]-1,2-oxazole |
|---|---|
| PubChem CID | 117233359 |
| Molecular Formula | C10H8ClNO2 |
| Molecular Weight | 209.63 g/mol |
| Exact Mass | 209.02 |
| IUPAC Name | 4-[(4-chlorophenyl)methoxy]-1,2-oxazole |
| SMILES | Clc1ccc(COc2cnoc2)cc1 |
| InChI | InChI=1S/C10H8ClNO2/c11-9-3-1-8(2-4-9)6-13-10-5-12-14-7-10/h1-5,7H,6H2 |
| InChIKey | YPLSYRYCWIYTOT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.63 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |