C17H15ClFNO — CID 102858082
3-[2-[(3-chloro-2-fluorophenyl)methoxy]-5-methylphenyl]prop-2-yn-1-amine (PubChem CID 102858082) has the molecular formula C17H15ClFNO and a molecular weight of 303.76 g/mol. Its IUPAC name is 3-[2-[(3-chloro-2-fluorophenyl)methoxy]-5-methylphenyl]prop-2-yn-1-amine.
| Compound Name | 3-[2-[(3-chloro-2-fluorophenyl)methoxy]-5-methylphenyl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 102858082 |
| Molecular Formula | C17H15ClFNO |
| Molecular Weight | 303.76 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 3-[2-[(3-chloro-2-fluorophenyl)methoxy]-5-methylphenyl]prop-2-yn-1-amine |
| SMILES | Cc1ccc(OCc2cccc(Cl)c2F)c(C#CCN)c1 |
| InChI | InChI=1S/C17H15ClFNO/c1-12-7-8-16(13(10-12)5-3-9-20)21-11-14-4-2-6-15(18)17(14)19/h2,4,6-8,10H,9,11,20H2,1H3 |
| InChIKey | IUWMNAHYSQWXAU-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.76 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|