C15H17FO3 — CID 106203860
(E)-3-[5-(2-cyclopropylethoxymethyl)-2-fluorophenyl]prop-2-enoic acid (PubChem CID 106203860) has the molecular formula C15H17FO3 and a molecular weight of 264.30 g/mol. Its IUPAC name is (E)-3-[5-(2-cyclopropylethoxymethyl)-2-fluorophenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-(2-cyclopropylethoxymethyl)-2-fluorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 106203860 |
| Molecular Formula | C15H17FO3 |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | (E)-3-[5-(2-cyclopropylethoxymethyl)-2-fluorophenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cc(COCCC2CC2)ccc1F |
| InChI | InChI=1S/C15H17FO3/c16-14-5-3-12(9-13(14)4-6-15(17)18)10-19-8-7-11-1-2-11/h3-6,9,11H,1-2,7-8,10H2,(H,17,18)/b6-4+ |
| InChIKey | VOMBELYHGNTIBO-GQCTYLIASA-N |
| XLogP | 3.24 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|