C12H19NO4 — CID 115229222
[methyl-[(3,4,5-trimethoxyphenyl)methyl]amino]methanol (PubChem CID 115229222) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is [methyl-[(3,4,5-trimethoxyphenyl)methyl]amino]methanol.
| Compound Name | [methyl-[(3,4,5-trimethoxyphenyl)methyl]amino]methanol |
|---|---|
| PubChem CID | 115229222 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | [methyl-[(3,4,5-trimethoxyphenyl)methyl]amino]methanol |
| SMILES | COc1cc(CN(C)CO)cc(OC)c1OC |
| InChI | InChI=1S/C12H19NO4/c1-13(8-14)7-9-5-10(15-2)12(17-4)11(6-9)16-3/h5-6,14H,7-8H2,1-4H3 |
| InChIKey | RIRQATFDKCGSGA-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|