C15H22N2O4 — CID 113095862
3-cyclopropyl-1-methyl-1-[(3,4,5-trimethoxyphenyl)methyl]urea (PubChem CID 113095862) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is 3-cyclopropyl-1-methyl-1-[(3,4,5-trimethoxyphenyl)methyl]urea.
| Compound Name | 3-cyclopropyl-1-methyl-1-[(3,4,5-trimethoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 113095862 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 3-cyclopropyl-1-methyl-1-[(3,4,5-trimethoxyphenyl)methyl]urea |
| SMILES | COc1cc(CN(C)C(=O)NC2CC2)cc(OC)c1OC |
| InChI | InChI=1S/C15H22N2O4/c1-17(15(18)16-11-5-6-11)9-10-7-12(19-2)14(21-4)13(8-10)20-3/h7-8,11H,5-6,9H2,1-4H3,(H,16,18) |
| InChIKey | KRMZRIKHHJRZTJ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |