C23H35N3O4S — CID 12004841
N-cyclopentyl-2-[[cyclopentyl-[(3,4,5-trimethoxyphenyl)methyl]carbamothioyl]amino]acetamide (PubChem CID 12004841) has the molecular formula C23H35N3O4S and a molecular weight of 449.62 g/mol. Its IUPAC name is N-cyclopentyl-2-[[cyclopentyl-[(3,4,5-trimethoxyphenyl)methyl]carbamothioyl]amino]acetamide.
| Compound Name | N-cyclopentyl-2-[[cyclopentyl-[(3,4,5-trimethoxyphenyl)methyl]carbamothioyl]amino]acetamide |
|---|---|
| PubChem CID | 12004841 |
| Molecular Formula | C23H35N3O4S |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | N-cyclopentyl-2-[[cyclopentyl-[(3,4,5-trimethoxyphenyl)methyl]carbamothioyl]amino]acetamide |
| SMILES | COc1cc(CN(C(=S)NCC(=O)NC2CCCC2)C2CCCC2)cc(OC)c1OC |
| InChI | InChI=1S/C23H35N3O4S/c1-28-19-12-16(13-20(29-2)22(19)30-3)15-26(18-10-6-7-11-18)23(31)24-14-21(27)25-17-8-4-5-9-17/h12-13,17-18H,4-11,14-15H2,1-3H3,(H,24,31)(H,25,27) |
| InChIKey | VEQVDDPRWKKZQC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|