C21H32N2O3S — CID 3396984
1,3-dicyclopentyl-1-[(2,3,4-trimethoxyphenyl)methyl]thiourea (PubChem CID 3396984) has the molecular formula C21H32N2O3S and a molecular weight of 392.57 g/mol. Its IUPAC name is 1,3-dicyclopentyl-1-[(2,3,4-trimethoxyphenyl)methyl]thiourea.
| Compound Name | 1,3-dicyclopentyl-1-[(2,3,4-trimethoxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 3396984 |
| Molecular Formula | C21H32N2O3S |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 1,3-dicyclopentyl-1-[(2,3,4-trimethoxyphenyl)methyl]thiourea |
| SMILES | COc1ccc(CN(C(=S)NC2CCCC2)C2CCCC2)c(OC)c1OC |
| InChI | InChI=1S/C21H32N2O3S/c1-24-18-13-12-15(19(25-2)20(18)26-3)14-23(17-10-6-7-11-17)21(27)22-16-8-4-5-9-16/h12-13,16-17H,4-11,14H2,1-3H3,(H,22,27) |
| InChIKey | AEJASBHYFSICSB-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|