C20H32N2O2S — CID 5180319
1-cyclopentyl-1-[(2,4-dimethoxyphenyl)methyl]-3-pentylthiourea (PubChem CID 5180319) has the molecular formula C20H32N2O2S and a molecular weight of 364.56 g/mol. Its IUPAC name is 1-cyclopentyl-1-[(2,4-dimethoxyphenyl)methyl]-3-pentylthiourea.
| Compound Name | 1-cyclopentyl-1-[(2,4-dimethoxyphenyl)methyl]-3-pentylthiourea |
|---|---|
| PubChem CID | 5180319 |
| Molecular Formula | C20H32N2O2S |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 1-cyclopentyl-1-[(2,4-dimethoxyphenyl)methyl]-3-pentylthiourea |
| SMILES | CCCCCNC(=S)N(Cc1ccc(OC)cc1OC)C1CCCC1 |
| InChI | InChI=1S/C20H32N2O2S/c1-4-5-8-13-21-20(25)22(17-9-6-7-10-17)15-16-11-12-18(23-2)14-19(16)24-3/h11-12,14,17H,4-10,13,15H2,1-3H3,(H,21,25) |
| InChIKey | SPZVPFDWOMQAJL-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|