C23H38N2O2S — CID 3256381
1-cyclopentyl-1-[(2,4-dimethoxyphenyl)methyl]-3-octylthiourea (PubChem CID 3256381) has the molecular formula C23H38N2O2S and a molecular weight of 406.64 g/mol. Its IUPAC name is 1-cyclopentyl-1-[(2,4-dimethoxyphenyl)methyl]-3-octylthiourea.
| Compound Name | 1-cyclopentyl-1-[(2,4-dimethoxyphenyl)methyl]-3-octylthiourea |
|---|---|
| PubChem CID | 3256381 |
| Molecular Formula | C23H38N2O2S |
| Molecular Weight | 406.64 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | 1-cyclopentyl-1-[(2,4-dimethoxyphenyl)methyl]-3-octylthiourea |
| SMILES | CCCCCCCCNC(=S)N(Cc1ccc(OC)cc1OC)C1CCCC1 |
| InChI | InChI=1S/C23H38N2O2S/c1-4-5-6-7-8-11-16-24-23(28)25(20-12-9-10-13-20)18-19-14-15-21(26-2)17-22(19)27-3/h14-15,17,20H,4-13,16,18H2,1-3H3,(H,24,28) |
| InChIKey | FJDRWOPZCBZTSB-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.64 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|