C18H28N2O2S — CID 8786326
1-[(2,4-dimethoxyphenyl)methyl]-1-methyl-3-[(1S,2R)-2-methylcyclohexyl]thiourea (PubChem CID 8786326) has the molecular formula C18H28N2O2S and a molecular weight of 336.50 g/mol. Its IUPAC name is 1-[(2,4-dimethoxyphenyl)methyl]-1-methyl-3-[(1S,2R)-2-methylcyclohexyl]thiourea.
| Compound Name | 1-[(2,4-dimethoxyphenyl)methyl]-1-methyl-3-[(1S,2R)-2-methylcyclohexyl]thiourea |
|---|---|
| PubChem CID | 8786326 |
| Molecular Formula | C18H28N2O2S |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | 1-[(2,4-dimethoxyphenyl)methyl]-1-methyl-3-[(1S,2R)-2-methylcyclohexyl]thiourea |
| SMILES | COc1ccc(CN(C)C(=S)N[C@H]2CCCC[C@H]2C)c(OC)c1 |
| InChI | InChI=1S/C18H28N2O2S/c1-13-7-5-6-8-16(13)19-18(23)20(2)12-14-9-10-15(21-3)11-17(14)22-4/h9-11,13,16H,5-8,12H2,1-4H3,(H,19,23)/t13-,16+/m1/s1 |
| InChIKey | CWUZXTGINWHVPU-CJNGLKHVSA-N |
| XLogP | 3.59 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|