C14H22N2O2S — CID 7944898
1-[(2,4-dimethoxyphenyl)methyl]-1-methyl-3-propylthiourea (PubChem CID 7944898) has the molecular formula C14H22N2O2S and a molecular weight of 282.41 g/mol. Its IUPAC name is 1-[(2,4-dimethoxyphenyl)methyl]-1-methyl-3-propylthiourea.
| Compound Name | 1-[(2,4-dimethoxyphenyl)methyl]-1-methyl-3-propylthiourea |
|---|---|
| PubChem CID | 7944898 |
| Molecular Formula | C14H22N2O2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 1-[(2,4-dimethoxyphenyl)methyl]-1-methyl-3-propylthiourea |
| SMILES | CCCNC(=S)N(C)Cc1ccc(OC)cc1OC |
| InChI | InChI=1S/C14H22N2O2S/c1-5-8-15-14(19)16(2)10-11-6-7-12(17-3)9-13(11)18-4/h6-7,9H,5,8,10H2,1-4H3,(H,15,19) |
| InChIKey | ITPHJYOTRLLRDH-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|