C22H28N2O3S — CID 17370509
1-cyclopentyl-3-phenyl-1-[(2,3,4-trimethoxyphenyl)methyl]thiourea (PubChem CID 17370509) has the molecular formula C22H28N2O3S and a molecular weight of 400.54 g/mol. Its IUPAC name is 1-cyclopentyl-3-phenyl-1-[(2,3,4-trimethoxyphenyl)methyl]thiourea.
| Compound Name | 1-cyclopentyl-3-phenyl-1-[(2,3,4-trimethoxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 17370509 |
| Molecular Formula | C22H28N2O3S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 1-cyclopentyl-3-phenyl-1-[(2,3,4-trimethoxyphenyl)methyl]thiourea |
| SMILES | COc1ccc(CN(C(=S)Nc2ccccc2)C2CCCC2)c(OC)c1OC |
| InChI | InChI=1S/C22H28N2O3S/c1-25-19-14-13-16(20(26-2)21(19)27-3)15-24(18-11-7-8-12-18)22(28)23-17-9-5-4-6-10-17/h4-6,9-10,13-14,18H,7-8,11-12,15H2,1-3H3,(H,23,28) |
| InChIKey | HDTPKDVCOMQFAB-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|