C24H30N2O5S — CID 3540445
methyl 2-[[cyclopentyl-[(2,3,4-trimethoxyphenyl)methyl]carbamothioyl]amino]benzoate (PubChem CID 3540445) has the molecular formula C24H30N2O5S and a molecular weight of 458.58 g/mol. Its IUPAC name is methyl 2-[[cyclopentyl-[(2,3,4-trimethoxyphenyl)methyl]carbamothioyl]amino]benzoate.
| Compound Name | methyl 2-[[cyclopentyl-[(2,3,4-trimethoxyphenyl)methyl]carbamothioyl]amino]benzoate |
|---|---|
| PubChem CID | 3540445 |
| Molecular Formula | C24H30N2O5S |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | methyl 2-[[cyclopentyl-[(2,3,4-trimethoxyphenyl)methyl]carbamothioyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=S)N(Cc1ccc(OC)c(OC)c1OC)C1CCCC1 |
| InChI | InChI=1S/C24H30N2O5S/c1-28-20-14-13-16(21(29-2)22(20)30-3)15-26(17-9-5-6-10-17)24(32)25-19-12-8-7-11-18(19)23(27)31-4/h7-8,11-14,17H,5-6,9-10,15H2,1-4H3,(H,25,32) |
| InChIKey | PJTZWFRTPQLRQI-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|