C16H23NO2 — CID 134931264
(2S,5R)-5-methoxy-6-methyl-2-phenylmethoxyheptanenitrile (PubChem CID 134931264) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is (2S,5R)-5-methoxy-6-methyl-2-phenylmethoxyheptanenitrile.
| Compound Name | (2S,5R)-5-methoxy-6-methyl-2-phenylmethoxyheptanenitrile |
|---|---|
| PubChem CID | 134931264 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | (2S,5R)-5-methoxy-6-methyl-2-phenylmethoxyheptanenitrile |
| SMILES | CO[C@H](CC[C@@H](C#N)OCc1ccccc1)C(C)C |
| InChI | InChI=1S/C16H23NO2/c1-13(2)16(18-3)10-9-15(11-17)19-12-14-7-5-4-6-8-14/h4-8,13,15-16H,9-10,12H2,1-3H3/t15-,16+/m0/s1 |
| InChIKey | ZEBLXXJEJVSBMZ-JKSUJKDBSA-N |
| XLogP | 3.55 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |